C12H15ClN4O4S — CID 71636023
6-nitro-2-piperidin-3-ylsulfonyl-1H-benzimidazole;hydrochloride (PubChem CID 71636023) has the molecular formula C12H15ClN4O4S and a molecular weight of 346.80 g/mol. Its IUPAC name is 6-nitro-2-piperidin-3-ylsulfonyl-1H-benzimidazole;hydrochloride.
| Compound Name | 6-nitro-2-piperidin-3-ylsulfonyl-1H-benzimidazole;hydrochloride |
|---|---|
| PubChem CID | 71636023 |
| Molecular Formula | C12H15ClN4O4S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 6-nitro-2-piperidin-3-ylsulfonyl-1H-benzimidazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2nc(S(=O)(=O)C3CCCNC3)[nH]c2c1 |
| InChI | InChI=1S/C12H14N4O4S.ClH/c17-16(18)8-3-4-10-11(6-8)15-12(14-10)21(19,20)9-2-1-5-13-7-9;/h3-4,6,9,13H,1-2,5,7H2,(H,14,15);1H |
| InChIKey | DXYQJEPENBFUHB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|