C11H12N4O4S — CID 71636026
6-nitro-2-pyrrolidin-3-ylsulfonyl-1H-benzimidazole (PubChem CID 71636026) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 6-nitro-2-pyrrolidin-3-ylsulfonyl-1H-benzimidazole.
| Compound Name | 6-nitro-2-pyrrolidin-3-ylsulfonyl-1H-benzimidazole |
|---|---|
| PubChem CID | 71636026 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 6-nitro-2-pyrrolidin-3-ylsulfonyl-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc2nc(S(=O)(=O)C3CCNC3)[nH]c2c1 |
| InChI | InChI=1S/C11H12N4O4S/c16-15(17)7-1-2-9-10(5-7)14-11(13-9)20(18,19)8-3-4-12-6-8/h1-2,5,8,12H,3-4,6H2,(H,13,14) |
| InChIKey | RWPDKGAWBLAGNI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|