C12H14ClN3O4 — CID 71635920
5-nitro-2-piperidin-3-yloxy-1,3-benzoxazole;hydrochloride (PubChem CID 71635920) has the molecular formula C12H14ClN3O4 and a molecular weight of 299.71 g/mol. Its IUPAC name is 5-nitro-2-piperidin-3-yloxy-1,3-benzoxazole;hydrochloride.
| Compound Name | 5-nitro-2-piperidin-3-yloxy-1,3-benzoxazole;hydrochloride |
|---|---|
| PubChem CID | 71635920 |
| Molecular Formula | C12H14ClN3O4 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 5-nitro-2-piperidin-3-yloxy-1,3-benzoxazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2oc(OC3CCCNC3)nc2c1 |
| InChI | InChI=1S/C12H13N3O4.ClH/c16-15(17)8-3-4-11-10(6-8)14-12(19-11)18-9-2-1-5-13-7-9;/h3-4,6,9,13H,1-2,5,7H2;1H |
| InChIKey | BLIHWFFTLZZEGC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|