About 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride
5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride (PubChem CID 71635918) has the molecular formula C11H12ClN3O4
and a molecular weight of 285.69 g/mol. Its IUPAC name is 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride.
Molecular Properties
| Compound Name | 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride |
| PubChem CID | 71635918 |
| Molecular Formula | C11H12ClN3O4 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2oc(O[C@H]3CCNC3)nc2c1 |
| InChI | InChI=1S/C11H11N3O4.ClH/c15-14(16)7-1-2-10-9(5-7)13-11(18-10)17-8-3-4-12-6-8;/h1-2,5,8,12H,3-4,6H2;1H/t8-;/m0./s1 |
| InChIKey | UQJWSZXORJJKTR-QRPNPIFTSA-N |
| XLogP | 1.90 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride?
The IUPAC name of 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride (CID 71635918) is 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride.
What is the SMILES notation for 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride?
The canonical SMILES for 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride is Cl.O=[N+]([O-])c1ccc2oc(O[C@H]3CCNC3)nc2c1.
What is the InChIKey of 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride?
The InChIKey is UQJWSZXORJJKTR-QRPNPIFTSA-N. The full InChI is InChI=1S/C11H11N3O4.ClH/c15-14(16)7-1-2-10-9(5-7)13-11(18-10)17-8-3-4-12-6-8;/h1-2,5,8,12H,3-4,6H2;1H/t8-;/m0./s1.
What are the key properties of 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride?
5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride has a molecular weight of 285.69 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-[(3S)-pyrrolidin-3-yl]oxy-1,3-benzoxazole;hydrochloride is sourced from PubChem (CID 71635918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).