C13H17ClN4O3 — CID 71640902
N-methyl-5-nitro-N-[(3R)-piperidin-3-yl]-1,3-benzoxazol-2-amine;hydrochloride (PubChem CID 71640902) has the molecular formula C13H17ClN4O3 and a molecular weight of 312.76 g/mol. Its IUPAC name is N-methyl-5-nitro-N-[(3R)-piperidin-3-yl]-1,3-benzoxazol-2-amine;hydrochloride.
| Compound Name | N-methyl-5-nitro-N-[(3R)-piperidin-3-yl]-1,3-benzoxazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71640902 |
| Molecular Formula | C13H17ClN4O3 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-methyl-5-nitro-N-[(3R)-piperidin-3-yl]-1,3-benzoxazol-2-amine;hydrochloride |
| SMILES | CN(c1nc2cc([N+](=O)[O-])ccc2o1)[C@@H]1CCCNC1.Cl |
| InChI | InChI=1S/C13H16N4O3.ClH/c1-16(10-3-2-6-14-8-10)13-15-11-7-9(17(18)19)4-5-12(11)20-13;/h4-5,7,10,14H,2-3,6,8H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | JMRNIJMJIDOCPV-HNCPQSOCSA-N |
| XLogP | 2.35 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|