C12H14ClN5O2 — CID 71635770
6-nitro-N-[(3S)-pyrrolidin-3-yl]quinoxalin-2-amine;hydrochloride (PubChem CID 71635770) has the molecular formula C12H14ClN5O2 and a molecular weight of 295.73 g/mol. Its IUPAC name is 6-nitro-N-[(3S)-pyrrolidin-3-yl]quinoxalin-2-amine;hydrochloride.
| Compound Name | 6-nitro-N-[(3S)-pyrrolidin-3-yl]quinoxalin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71635770 |
| Molecular Formula | C12H14ClN5O2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 6-nitro-N-[(3S)-pyrrolidin-3-yl]quinoxalin-2-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2nc(N[C@H]3CCNC3)cnc2c1 |
| InChI | InChI=1S/C12H13N5O2.ClH/c18-17(19)9-1-2-10-11(5-9)14-7-12(16-10)15-8-3-4-13-6-8;/h1-2,5,7-8,13H,3-4,6H2,(H,15,16);1H/t8-;/m0./s1 |
| InChIKey | OODZNXKBBYWZDC-QRPNPIFTSA-N |
| XLogP | 1.73 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|