C13H16ClN5O2 — CID 71635780
6-nitro-N-(pyrrolidin-2-ylmethyl)quinoxalin-2-amine;hydrochloride (PubChem CID 71635780) has the molecular formula C13H16ClN5O2 and a molecular weight of 309.76 g/mol. Its IUPAC name is 6-nitro-N-(pyrrolidin-2-ylmethyl)quinoxalin-2-amine;hydrochloride.
| Compound Name | 6-nitro-N-(pyrrolidin-2-ylmethyl)quinoxalin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71635780 |
| Molecular Formula | C13H16ClN5O2 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 6-nitro-N-(pyrrolidin-2-ylmethyl)quinoxalin-2-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc2nc(NCC3CCCN3)cnc2c1 |
| InChI | InChI=1S/C13H15N5O2.ClH/c19-18(20)10-3-4-11-12(6-10)15-8-13(17-11)16-7-9-2-1-5-14-9;/h3-4,6,8-9,14H,1-2,5,7H2,(H,16,17);1H |
| InChIKey | IBYNAIZPJIZAOP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|