C11H11ClN2S — CID 63030611
5-chloro-2-pyrrolidin-3-yl-1,3-benzothiazole (PubChem CID 63030611) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 5-chloro-2-pyrrolidin-3-yl-1,3-benzothiazole.
| Compound Name | 5-chloro-2-pyrrolidin-3-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 63030611 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 5-chloro-2-pyrrolidin-3-yl-1,3-benzothiazole |
| SMILES | Clc1ccc2sc(C3CCNC3)nc2c1 |
| InChI | InChI=1S/C11H11ClN2S/c12-8-1-2-10-9(5-8)14-11(15-10)7-3-4-13-6-7/h1-2,5,7,13H,3-4,6H2 |
| InChIKey | OVJAUXGWBXCNDQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |