C15H18N2S — CID 117399909
2-cyclopropyl-5-piperidin-4-yl-1,3-benzothiazole (PubChem CID 117399909) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 2-cyclopropyl-5-piperidin-4-yl-1,3-benzothiazole.
| Compound Name | 2-cyclopropyl-5-piperidin-4-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 117399909 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-cyclopropyl-5-piperidin-4-yl-1,3-benzothiazole |
| SMILES | c1cc2sc(C3CC3)nc2cc1C1CCNCC1 |
| InChI | InChI=1S/C15H18N2S/c1-2-11(1)15-17-13-9-12(3-4-14(13)18-15)10-5-7-16-8-6-10/h3-4,9-11,16H,1-2,5-8H2 |
| InChIKey | BWMOLZNNRXJQPN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |