C12H14N2O — CID 84776818
6-piperidin-4-yl-2,1-benzoxazole (PubChem CID 84776818) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 6-piperidin-4-yl-2,1-benzoxazole.
| Compound Name | 6-piperidin-4-yl-2,1-benzoxazole |
|---|---|
| PubChem CID | 84776818 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 6-piperidin-4-yl-2,1-benzoxazole |
| SMILES | c1cc2conc2cc1C1CCNCC1 |
| InChI | InChI=1S/C12H14N2O/c1-2-11-8-15-14-12(11)7-10(1)9-3-5-13-6-4-9/h1-2,7-9,13H,3-6H2 |
| InChIKey | HKACPONPMHVXJL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |