C18H29N3 — CID 91457940
ethane;7-piperidin-4-ylisoquinolin-1-amine (PubChem CID 91457940) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is ethane;7-piperidin-4-ylisoquinolin-1-amine.
| Compound Name | ethane;7-piperidin-4-ylisoquinolin-1-amine |
|---|---|
| PubChem CID | 91457940 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | ethane;7-piperidin-4-ylisoquinolin-1-amine |
| SMILES | CC.CC.Nc1nccc2ccc(C3CCNCC3)cc12 |
| InChI | InChI=1S/C14H17N3.2C2H6/c15-14-13-9-12(10-3-6-16-7-4-10)2-1-11(13)5-8-17-14;2*1-2/h1-2,5,8-10,16H,3-4,6-7H2,(H2,15,17);2*1-2H3 |
| InChIKey | BKTJQCJLCJKHIH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |