About 2-ethoxy-4-piperidin-4-ylpyridine;methane
2-ethoxy-4-piperidin-4-ylpyridine;methane (PubChem CID 158415857) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-ethoxy-4-piperidin-4-ylpyridine;methane.
Molecular Properties
| Compound Name | 2-ethoxy-4-piperidin-4-ylpyridine;methane |
| PubChem CID | 158415857 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-ethoxy-4-piperidin-4-ylpyridine;methane |
| SMILES | C.CCOc1cc(C2CCNCC2)ccn1 |
| InChI | InChI=1S/C12H18N2O.CH4/c1-2-15-12-9-11(5-8-14-12)10-3-6-13-7-4-10;/h5,8-10,13H,2-4,6-7H2,1H3;1H4 |
| InChIKey | GZWQAABJZUIDKD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxy-4-piperidin-4-ylpyridine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-4-piperidin-4-ylpyridine;methane?
The IUPAC name of 2-ethoxy-4-piperidin-4-ylpyridine;methane (CID 158415857) is 2-ethoxy-4-piperidin-4-ylpyridine;methane.
What is the SMILES notation for 2-ethoxy-4-piperidin-4-ylpyridine;methane?
The canonical SMILES for 2-ethoxy-4-piperidin-4-ylpyridine;methane is C.CCOc1cc(C2CCNCC2)ccn1.
What is the InChIKey of 2-ethoxy-4-piperidin-4-ylpyridine;methane?
The InChIKey is GZWQAABJZUIDKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O.CH4/c1-2-15-12-9-11(5-8-14-12)10-3-6-13-7-4-10;/h5,8-10,13H,2-4,6-7H2,1H3;1H4.
What are the key properties of 2-ethoxy-4-piperidin-4-ylpyridine;methane?
2-ethoxy-4-piperidin-4-ylpyridine;methane has a molecular weight of 222.33 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-4-piperidin-4-ylpyridine;methane is sourced from PubChem (CID 158415857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).