C12H20Cl2N2O2 — CID 162422911
4-methoxy-2-(piperidin-4-ylmethoxy)pyridine;dihydrochloride (PubChem CID 162422911) has the molecular formula C12H20Cl2N2O2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 4-methoxy-2-(piperidin-4-ylmethoxy)pyridine;dihydrochloride.
| Compound Name | 4-methoxy-2-(piperidin-4-ylmethoxy)pyridine;dihydrochloride |
|---|---|
| PubChem CID | 162422911 |
| Molecular Formula | C12H20Cl2N2O2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-methoxy-2-(piperidin-4-ylmethoxy)pyridine;dihydrochloride |
| SMILES | COc1ccnc(OCC2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C12H18N2O2.2ClH/c1-15-11-4-7-14-12(8-11)16-9-10-2-5-13-6-3-10;;/h4,7-8,10,13H,2-3,5-6,9H2,1H3;2*1H |
| InChIKey | ROJRJZSKTVKZQJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |