C13H18ClN3O — CID 71643682
2-(2-piperidin-4-ylethoxy)pyridine-4-carbonitrile;hydrochloride (PubChem CID 71643682) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-(2-piperidin-4-ylethoxy)pyridine-4-carbonitrile;hydrochloride.
| Compound Name | 2-(2-piperidin-4-ylethoxy)pyridine-4-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 71643682 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(2-piperidin-4-ylethoxy)pyridine-4-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccnc(OCCC2CCNCC2)c1 |
| InChI | InChI=1S/C13H17N3O.ClH/c14-10-12-3-7-16-13(9-12)17-8-4-11-1-5-15-6-2-11;/h3,7,9,11,15H,1-2,4-6,8H2;1H |
| InChIKey | AHSHTDLUVHDUCK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |