C12H15N3OS — CID 97166435
2-[(S)-piperidin-4-ylmethylsulfinyl]pyridine-4-carbonitrile (PubChem CID 97166435) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-[(S)-piperidin-4-ylmethylsulfinyl]pyridine-4-carbonitrile.
| Compound Name | 2-[(S)-piperidin-4-ylmethylsulfinyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 97166435 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-[(S)-piperidin-4-ylmethylsulfinyl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc([S@@](=O)CC2CCNCC2)c1 |
| InChI | InChI=1S/C12H15N3OS/c13-8-11-3-6-15-12(7-11)17(16)9-10-1-4-14-5-2-10/h3,6-7,10,14H,1-2,4-5,9H2/t17-/m0/s1 |
| InChIKey | FOXYXXFGQGSLNY-KRWDZBQOSA-N |
| XLogP | 1.06 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |