C11H13N3OS — CID 71646106
2-(pyrrolidin-2-ylmethylsulfinyl)pyridine-4-carbonitrile (PubChem CID 71646106) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-(pyrrolidin-2-ylmethylsulfinyl)pyridine-4-carbonitrile.
| Compound Name | 2-(pyrrolidin-2-ylmethylsulfinyl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 71646106 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(pyrrolidin-2-ylmethylsulfinyl)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(S(=O)CC2CCCN2)c1 |
| InChI | InChI=1S/C11H13N3OS/c12-7-9-3-5-14-11(6-9)16(15)8-10-2-1-4-13-10/h3,5-6,10,13H,1-2,4,8H2 |
| InChIKey | XZRNIKFWCTYSPA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |