C9H12ClN3OS — CID 97163785
2-chloro-4-[(S)-[(2R)-pyrrolidin-2-yl]methylsulfinyl]pyrimidine (PubChem CID 97163785) has the molecular formula C9H12ClN3OS and a molecular weight of 245.73 g/mol. Its IUPAC name is 2-chloro-4-[(S)-[(2R)-pyrrolidin-2-yl]methylsulfinyl]pyrimidine.
| Compound Name | 2-chloro-4-[(S)-[(2R)-pyrrolidin-2-yl]methylsulfinyl]pyrimidine |
|---|---|
| PubChem CID | 97163785 |
| Molecular Formula | C9H12ClN3OS |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-chloro-4-[(S)-[(2R)-pyrrolidin-2-yl]methylsulfinyl]pyrimidine |
| SMILES | O=[S@@](C[C@H]1CCCN1)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C9H12ClN3OS/c10-9-12-5-3-8(13-9)15(14)6-7-2-1-4-11-7/h3,5,7,11H,1-2,4,6H2/t7-,15+/m1/s1 |
| InChIKey | LDXQNHMEBZIWIE-MLXNANBUSA-N |
| XLogP | 0.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |