C14H17N3OS — CID 97166212
2-[(R)-[(2R)-piperidin-2-yl]methylsulfinyl]quinoxaline (PubChem CID 97166212) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 2-[(R)-[(2R)-piperidin-2-yl]methylsulfinyl]quinoxaline.
| Compound Name | 2-[(R)-[(2R)-piperidin-2-yl]methylsulfinyl]quinoxaline |
|---|---|
| PubChem CID | 97166212 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-[(R)-[(2R)-piperidin-2-yl]methylsulfinyl]quinoxaline |
| SMILES | O=[S@](C[C@H]1CCCCN1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C14H17N3OS/c18-19(10-11-5-3-4-8-15-11)14-9-16-12-6-1-2-7-13(12)17-14/h1-2,6-7,9,11,15H,3-5,8,10H2/t11-,19-/m1/s1 |
| InChIKey | WPXGTGJTWVGWON-NSPYISDASA-N |
| XLogP | 1.88 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |