C11H15BrN2OS — CID 97178213
2-bromo-6-[(R)-[(2R)-piperidin-2-yl]methylsulfinyl]pyridine (PubChem CID 97178213) has the molecular formula C11H15BrN2OS and a molecular weight of 303.22 g/mol. Its IUPAC name is 2-bromo-6-[(R)-[(2R)-piperidin-2-yl]methylsulfinyl]pyridine.
| Compound Name | 2-bromo-6-[(R)-[(2R)-piperidin-2-yl]methylsulfinyl]pyridine |
|---|---|
| PubChem CID | 97178213 |
| Molecular Formula | C11H15BrN2OS |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-bromo-6-[(R)-[(2R)-piperidin-2-yl]methylsulfinyl]pyridine |
| SMILES | O=[S@](C[C@H]1CCCCN1)c1cccc(Br)n1 |
| InChI | InChI=1S/C11H15BrN2OS/c12-10-5-3-6-11(14-10)16(15)8-9-4-1-2-7-13-9/h3,5-6,9,13H,1-2,4,7-8H2/t9-,16-/m1/s1 |
| InChIKey | MMLIHXRXBDAPCP-JDNHERCYSA-N |
| XLogP | 2.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|