C20H24N4O — CID 134329906
2-amino-4-(3-ethyl-5-piperidin-4-yl-1H-indol-2-yl)pyridin-3-ol (PubChem CID 134329906) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-amino-4-(3-ethyl-5-piperidin-4-yl-1H-indol-2-yl)pyridin-3-ol.
| Compound Name | 2-amino-4-(3-ethyl-5-piperidin-4-yl-1H-indol-2-yl)pyridin-3-ol |
|---|---|
| PubChem CID | 134329906 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-amino-4-(3-ethyl-5-piperidin-4-yl-1H-indol-2-yl)pyridin-3-ol |
| SMILES | CCc1c(-c2ccnc(N)c2O)[nH]c2ccc(C3CCNCC3)cc12 |
| InChI | InChI=1S/C20H24N4O/c1-2-14-16-11-13(12-5-8-22-9-6-12)3-4-17(16)24-18(14)15-7-10-23-20(21)19(15)25/h3-4,7,10-12,22,24-25H,2,5-6,8-9H2,1H3,(H2,21,23) |
| InChIKey | KKGNFWXWOZESLY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |