C22H25N5O — CID 142594610
3-(3-ethyl-5-piperidin-4-yl-1H-indol-2-yl)-5-methoxyimidazo[1,2-a]pyrazine (PubChem CID 142594610) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 3-(3-ethyl-5-piperidin-4-yl-1H-indol-2-yl)-5-methoxyimidazo[1,2-a]pyrazine.
| Compound Name | 3-(3-ethyl-5-piperidin-4-yl-1H-indol-2-yl)-5-methoxyimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 142594610 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 3-(3-ethyl-5-piperidin-4-yl-1H-indol-2-yl)-5-methoxyimidazo[1,2-a]pyrazine |
| SMILES | CCc1c(-c2cnc3cncc(OC)n23)[nH]c2ccc(C3CCNCC3)cc12 |
| InChI | InChI=1S/C22H25N5O/c1-3-16-17-10-15(14-6-8-23-9-7-14)4-5-18(17)26-22(16)19-11-25-20-12-24-13-21(28-2)27(19)20/h4-5,10-14,23,26H,3,6-9H2,1-2H3 |
| InChIKey | UGFBVLLXNHWUPZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|