C24H31N3 — CID 134330051
3-ethyl-2-(2-methyl-4-pyridinyl)-5-(1-propan-2-ylpiperidin-4-yl)-1H-indole (PubChem CID 134330051) has the molecular formula C24H31N3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 3-ethyl-2-(2-methyl-4-pyridinyl)-5-(1-propan-2-ylpiperidin-4-yl)-1H-indole.
| Compound Name | 3-ethyl-2-(2-methyl-4-pyridinyl)-5-(1-propan-2-ylpiperidin-4-yl)-1H-indole |
|---|---|
| PubChem CID | 134330051 |
| Molecular Formula | C24H31N3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 3-ethyl-2-(2-methyl-4-pyridinyl)-5-(1-propan-2-ylpiperidin-4-yl)-1H-indole |
| SMILES | CCc1c(-c2ccnc(C)c2)[nH]c2ccc(C3CCN(C(C)C)CC3)cc12 |
| InChI | InChI=1S/C24H31N3/c1-5-21-22-15-19(18-9-12-27(13-10-18)16(2)3)6-7-23(22)26-24(21)20-8-11-25-17(4)14-20/h6-8,11,14-16,18,26H,5,9-10,12-13H2,1-4H3 |
| InChIKey | KPFYVTQBGUGUQJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |