C20H20ClF2N3 — CID 134329795
2-(2-chloro-4-pyridinyl)-3-(2,2-difluoroethyl)-5-piperidin-4-yl-1H-indole (PubChem CID 134329795) has the molecular formula C20H20ClF2N3 and a molecular weight of 375.85 g/mol. Its IUPAC name is 2-(2-chloro-4-pyridinyl)-3-(2,2-difluoroethyl)-5-piperidin-4-yl-1H-indole.
| Compound Name | 2-(2-chloro-4-pyridinyl)-3-(2,2-difluoroethyl)-5-piperidin-4-yl-1H-indole |
|---|---|
| PubChem CID | 134329795 |
| Molecular Formula | C20H20ClF2N3 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-(2-chloro-4-pyridinyl)-3-(2,2-difluoroethyl)-5-piperidin-4-yl-1H-indole |
| SMILES | FC(F)Cc1c(-c2ccnc(Cl)c2)[nH]c2ccc(C3CCNCC3)cc12 |
| InChI | InChI=1S/C20H20ClF2N3/c21-18-10-14(5-8-25-18)20-16(11-19(22)23)15-9-13(1-2-17(15)26-20)12-3-6-24-7-4-12/h1-2,5,8-10,12,19,24,26H,3-4,6-7,11H2 |
| InChIKey | YAIDWAMPVPDIBE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|