C21H23ClFN3 — CID 134330056
2-(5-chloro-2-fluoro-4-pyridinyl)-5-piperidin-4-yl-3-propan-2-yl-1H-indole (PubChem CID 134330056) has the molecular formula C21H23ClFN3 and a molecular weight of 371.89 g/mol. Its IUPAC name is 2-(5-chloro-2-fluoro-4-pyridinyl)-5-piperidin-4-yl-3-propan-2-yl-1H-indole.
| Compound Name | 2-(5-chloro-2-fluoro-4-pyridinyl)-5-piperidin-4-yl-3-propan-2-yl-1H-indole |
|---|---|
| PubChem CID | 134330056 |
| Molecular Formula | C21H23ClFN3 |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-(5-chloro-2-fluoro-4-pyridinyl)-5-piperidin-4-yl-3-propan-2-yl-1H-indole |
| SMILES | CC(C)c1c(-c2cc(F)ncc2Cl)[nH]c2ccc(C3CCNCC3)cc12 |
| InChI | InChI=1S/C21H23ClFN3/c1-12(2)20-16-9-14(13-5-7-24-8-6-13)3-4-18(16)26-21(20)15-10-19(23)25-11-17(15)22/h3-4,9-13,24,26H,5-8H2,1-2H3 |
| InChIKey | DQYLEYUDMWRAAZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|