About 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole
2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole (PubChem CID 134230741) has the molecular formula C25H32N2O2
and a molecular weight of 392.54 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole |
| PubChem CID | 134230741 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole |
| SMILES | COc1ccc(-c2[nH]c3ccc(C4CCNCC4)cc3c2CC(C)C)cc1OC |
| InChI | InChI=1S/C25H32N2O2/c1-16(2)13-21-20-14-18(17-9-11-26-12-10-17)5-7-22(20)27-25(21)19-6-8-23(28-3)24(15-19)29-4/h5-8,14-17,26-27H,9-13H2,1-4H3 |
| InChIKey | QGYGOAPWTDZPMT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole (CID 134230741) is 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole is COc1ccc(-c2[nH]c3ccc(C4CCNCC4)cc3c2CC(C)C)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole?
The InChIKey is QGYGOAPWTDZPMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N2O2/c1-16(2)13-21-20-14-18(17-9-11-26-12-10-17)5-7-22(20)27-25(21)19-6-8-23(28-3)24(15-19)29-4/h5-8,14-17,26-27H,9-13H2,1-4H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole?
2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole has a molecular weight of 392.54 g/mol, XLogP of 5.52, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5-piperidin-4-yl-1H-indole is sourced from PubChem (CID 134230741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).