C25H33N3O2 — CID 155226591
2-(3,4-dimethoxyphenyl)-N,3-diethyl-N-piperidin-4-yl-1H-indol-5-amine (PubChem CID 155226591) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N,3-diethyl-N-piperidin-4-yl-1H-indol-5-amine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N,3-diethyl-N-piperidin-4-yl-1H-indol-5-amine |
|---|---|
| PubChem CID | 155226591 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N,3-diethyl-N-piperidin-4-yl-1H-indol-5-amine |
| SMILES | CCc1c(-c2ccc(OC)c(OC)c2)[nH]c2ccc(N(CC)C3CCNCC3)cc12 |
| InChI | InChI=1S/C25H33N3O2/c1-5-20-21-16-19(28(6-2)18-11-13-26-14-12-18)8-9-22(21)27-25(20)17-7-10-23(29-3)24(15-17)30-4/h7-10,15-16,18,26-27H,5-6,11-14H2,1-4H3 |
| InChIKey | LVXWPCBCEVSFDN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |