C26H32N2O3 — CID 150682988
N-cycloheptyl-2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indole-5-carboxamide (PubChem CID 150682988) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-cycloheptyl-2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indole-5-carboxamide.
| Compound Name | N-cycloheptyl-2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 150682988 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-cycloheptyl-2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indole-5-carboxamide |
| SMILES | CCc1c(-c2ccc(OC)c(OC)c2)[nH]c2ccc(C(=O)NC3CCCCCC3)cc12 |
| InChI | InChI=1S/C26H32N2O3/c1-4-20-21-15-18(26(29)27-19-9-7-5-6-8-10-19)11-13-22(21)28-25(20)17-12-14-23(30-2)24(16-17)31-3/h11-16,19,28H,4-10H2,1-3H3,(H,27,29) |
| InChIKey | JIGNWDKLUHAGDP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |