C21H27NO2 — CID 143177705
2-(3,4-dimethoxyphenyl)-3-propyl-1H-indole;ethane (PubChem CID 143177705) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-propyl-1H-indole;ethane.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-propyl-1H-indole;ethane |
|---|---|
| PubChem CID | 143177705 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-propyl-1H-indole;ethane |
| SMILES | CC.CCCc1c(-c2ccc(OC)c(OC)c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H21NO2.C2H6/c1-4-7-15-14-8-5-6-9-16(14)20-19(15)13-10-11-17(21-2)18(12-13)22-3;1-2/h5-6,8-12,20H,4,7H2,1-3H3;1-2H3 |
| InChIKey | BTRZRRWDANREQG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |