C24H23NO3 — CID 71546977
2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole (PubChem CID 71546977) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole.
| Compound Name | 2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole |
|---|---|
| PubChem CID | 71546977 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole |
| SMILES | COc1cc(Cc2c(-c3ccccc3)[nH]c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C24H23NO3/c1-26-21-14-16(15-22(27-2)24(21)28-3)13-19-18-11-7-8-12-20(18)25-23(19)17-9-5-4-6-10-17/h4-12,14-15,25H,13H2,1-3H3 |
| InChIKey | WUMNMBFXRLJISW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |