C24H20FNO3 — CID 69097105
methyl 3-fluoro-5-[(6-methoxy-2-phenyl-1H-indol-3-yl)methyl]benzoate (PubChem CID 69097105) has the molecular formula C24H20FNO3 and a molecular weight of 389.43 g/mol. Its IUPAC name is methyl 3-fluoro-5-[(6-methoxy-2-phenyl-1H-indol-3-yl)methyl]benzoate.
| Compound Name | methyl 3-fluoro-5-[(6-methoxy-2-phenyl-1H-indol-3-yl)methyl]benzoate |
|---|---|
| PubChem CID | 69097105 |
| Molecular Formula | C24H20FNO3 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 3-fluoro-5-[(6-methoxy-2-phenyl-1H-indol-3-yl)methyl]benzoate |
| SMILES | COC(=O)c1cc(F)cc(Cc2c(-c3ccccc3)[nH]c3cc(OC)ccc23)c1 |
| InChI | InChI=1S/C24H20FNO3/c1-28-19-8-9-20-21(12-15-10-17(24(27)29-2)13-18(25)11-15)23(26-22(20)14-19)16-6-4-3-5-7-16/h3-11,13-14,26H,12H2,1-2H3 |
| InChIKey | GWVREILJXJYNKT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |