C25H23NO5 — CID 122183344
(4-methoxy-2-phenyl-1H-indol-3-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 122183344) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is (4-methoxy-2-phenyl-1H-indol-3-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (4-methoxy-2-phenyl-1H-indol-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 122183344 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (4-methoxy-2-phenyl-1H-indol-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2c(-c3ccccc3)[nH]c3cccc(OC)c23)cc(OC)c1OC |
| InChI | InChI=1S/C25H23NO5/c1-28-18-12-8-11-17-21(18)22(23(26-17)15-9-6-5-7-10-15)24(27)16-13-19(29-2)25(31-4)20(14-16)30-3/h5-14,26H,1-4H3 |
| InChIKey | FEZRZOGDMQJBAL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |