C20H18N2O4 — CID 53364049
(6-phenylpyrimidin-4-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 53364049) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is (6-phenylpyrimidin-4-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (6-phenylpyrimidin-4-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 53364049 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (6-phenylpyrimidin-4-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cc(-c3ccccc3)ncn2)cc(OC)c1OC |
| InChI | InChI=1S/C20H18N2O4/c1-24-17-9-14(10-18(25-2)20(17)26-3)19(23)16-11-15(21-12-22-16)13-7-5-4-6-8-13/h4-12H,1-3H3 |
| InChIKey | WORHRNDUVHXVIQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |