C24H21NO4 — CID 2359773
(2-phenylindolizin-3-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 2359773) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is (2-phenylindolizin-3-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (2-phenylindolizin-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 2359773 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (2-phenylindolizin-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2c(-c3ccccc3)cc3ccccn23)cc(OC)c1OC |
| InChI | InChI=1S/C24H21NO4/c1-27-20-13-17(14-21(28-2)24(20)29-3)23(26)22-19(16-9-5-4-6-10-16)15-18-11-7-8-12-25(18)22/h4-15H,1-3H3 |
| InChIKey | OJUOOAPGSSWVCY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |