C32H36Cl2N2O2 — CID 13029587
[3,5-dichloro-4-[3-(dibutylamino)propoxy]phenyl]-(2-phenylindolizin-3-yl)methanone (PubChem CID 13029587) has the molecular formula C32H36Cl2N2O2 and a molecular weight of 551.56 g/mol. Its IUPAC name is [3,5-dichloro-4-[3-(dibutylamino)propoxy]phenyl]-(2-phenylindolizin-3-yl)methanone.
| Compound Name | [3,5-dichloro-4-[3-(dibutylamino)propoxy]phenyl]-(2-phenylindolizin-3-yl)methanone |
|---|---|
| PubChem CID | 13029587 |
| Molecular Formula | C32H36Cl2N2O2 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | [3,5-dichloro-4-[3-(dibutylamino)propoxy]phenyl]-(2-phenylindolizin-3-yl)methanone |
| SMILES | CCCCN(CCCC)CCCOc1c(Cl)cc(C(=O)c2c(-c3ccccc3)cc3ccccn23)cc1Cl |
| InChI | InChI=1S/C32H36Cl2N2O2/c1-3-5-16-35(17-6-4-2)18-12-20-38-32-28(33)21-25(22-29(32)34)31(37)30-27(24-13-8-7-9-14-24)23-26-15-10-11-19-36(26)30/h7-11,13-15,19,21-23H,3-6,12,16-18,20H2,1-2H3 |
| InChIKey | ZZBIQRCKHFQKEX-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|