C32H35Br2ClN2O2 — CID 13069392
[1-bromo-2-(4-bromophenyl)indolizin-3-yl]-[3-chloro-4-[3-(dibutylamino)propoxy]phenyl]methanone (PubChem CID 13069392) has the molecular formula C32H35Br2ClN2O2 and a molecular weight of 674.91 g/mol. Its IUPAC name is [1-bromo-2-(4-bromophenyl)indolizin-3-yl]-[3-chloro-4-[3-(dibutylamino)propoxy]phenyl]methanone.
| Compound Name | [1-bromo-2-(4-bromophenyl)indolizin-3-yl]-[3-chloro-4-[3-(dibutylamino)propoxy]phenyl]methanone |
|---|---|
| PubChem CID | 13069392 |
| Molecular Formula | C32H35Br2ClN2O2 |
| Molecular Weight | 674.91 g/mol |
| Exact Mass | 672.08 |
| IUPAC Name | [1-bromo-2-(4-bromophenyl)indolizin-3-yl]-[3-chloro-4-[3-(dibutylamino)propoxy]phenyl]methanone |
| SMILES | CCCCN(CCCC)CCCOc1ccc(C(=O)c2c(-c3ccc(Br)cc3)c(Br)c3ccccn23)cc1Cl |
| InChI | InChI=1S/C32H35Br2ClN2O2/c1-3-5-17-36(18-6-4-2)19-9-21-39-28-16-13-24(22-26(28)35)32(38)31-29(23-11-14-25(33)15-12-23)30(34)27-10-7-8-20-37(27)31/h7-8,10-16,20,22H,3-6,9,17-19,21H2,1-2H3 |
| InChIKey | OVOBAGVKCQSBBL-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.91 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|