C33H39BrN2O3 — CID 13069439
[3-bromo-4-[3-(dibutylamino)propoxy]phenyl]-(1-methoxy-2-phenylindolizin-3-yl)methanone (PubChem CID 13069439) has the molecular formula C33H39BrN2O3 and a molecular weight of 591.59 g/mol. Its IUPAC name is [3-bromo-4-[3-(dibutylamino)propoxy]phenyl]-(1-methoxy-2-phenylindolizin-3-yl)methanone.
| Compound Name | [3-bromo-4-[3-(dibutylamino)propoxy]phenyl]-(1-methoxy-2-phenylindolizin-3-yl)methanone |
|---|---|
| PubChem CID | 13069439 |
| Molecular Formula | C33H39BrN2O3 |
| Molecular Weight | 591.59 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | [3-bromo-4-[3-(dibutylamino)propoxy]phenyl]-(1-methoxy-2-phenylindolizin-3-yl)methanone |
| SMILES | CCCCN(CCCC)CCCOc1ccc(C(=O)c2c(-c3ccccc3)c(OC)c3ccccn23)cc1Br |
| InChI | InChI=1S/C33H39BrN2O3/c1-4-6-19-35(20-7-5-2)21-13-23-39-29-18-17-26(24-27(29)34)32(37)31-30(25-14-9-8-10-15-25)33(38-3)28-16-11-12-22-36(28)31/h8-12,14-18,22,24H,4-7,13,19-21,23H2,1-3H3 |
| InChIKey | BCHWHEFBZLQNDF-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.59 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|