C33H38N2O4 — CID 19754424
3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-phenylindolizine-7-carboxylic acid (PubChem CID 19754424) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is 3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-phenylindolizine-7-carboxylic acid.
| Compound Name | 3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-phenylindolizine-7-carboxylic acid |
|---|---|
| PubChem CID | 19754424 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 3-[4-[3-(dibutylamino)propoxy]benzoyl]-2-phenylindolizine-7-carboxylic acid |
| SMILES | CCCCN(CCCC)CCCOc1ccc(C(=O)c2c(-c3ccccc3)cc3cc(C(=O)O)ccn23)cc1 |
| InChI | InChI=1S/C33H38N2O4/c1-3-5-18-34(19-6-4-2)20-10-22-39-29-15-13-26(14-16-29)32(36)31-30(25-11-8-7-9-12-25)24-28-23-27(33(37)38)17-21-35(28)31/h7-9,11-17,21,23-24H,3-6,10,18-20,22H2,1-2H3,(H,37,38) |
| InChIKey | YHGOZIIZTKXLOL-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_I(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|