C33H47N3O6 — CID 19754300
(5-amino-3-butyl-1-methylindol-2-yl)-[4-[3-(dibutylamino)propoxy]phenyl]methanone;oxalic acid (PubChem CID 19754300) has the molecular formula C33H47N3O6 and a molecular weight of 581.75 g/mol. Its IUPAC name is (5-amino-3-butyl-1-methylindol-2-yl)-[4-[3-(dibutylamino)propoxy]phenyl]methanone;oxalic acid.
| Compound Name | (5-amino-3-butyl-1-methylindol-2-yl)-[4-[3-(dibutylamino)propoxy]phenyl]methanone;oxalic acid |
|---|---|
| PubChem CID | 19754300 |
| Molecular Formula | C33H47N3O6 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | (5-amino-3-butyl-1-methylindol-2-yl)-[4-[3-(dibutylamino)propoxy]phenyl]methanone;oxalic acid |
| SMILES | CCCCc1c(C(=O)c2ccc(OCCCN(CCCC)CCCC)cc2)n(C)c2ccc(N)cc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C31H45N3O2.C2H2O4/c1-5-8-12-27-28-23-25(32)15-18-29(28)33(4)30(27)31(35)24-13-16-26(17-14-24)36-22-11-21-34(19-9-6-2)20-10-7-3;3-1(4)2(5)6/h13-18,23H,5-12,19-22,32H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | WUQXFWFFMVYNOF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|