C32H46N2O3 — CID 19754347
(5-amino-2-butyl-1-benzofuran-3-yl)-[4-[3-(dibutylamino)propoxy]-3,5-dimethylphenyl]methanone (PubChem CID 19754347) has the molecular formula C32H46N2O3 and a molecular weight of 506.73 g/mol. Its IUPAC name is (5-amino-2-butyl-1-benzofuran-3-yl)-[4-[3-(dibutylamino)propoxy]-3,5-dimethylphenyl]methanone.
| Compound Name | (5-amino-2-butyl-1-benzofuran-3-yl)-[4-[3-(dibutylamino)propoxy]-3,5-dimethylphenyl]methanone |
|---|---|
| PubChem CID | 19754347 |
| Molecular Formula | C32H46N2O3 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | (5-amino-2-butyl-1-benzofuran-3-yl)-[4-[3-(dibutylamino)propoxy]-3,5-dimethylphenyl]methanone |
| SMILES | CCCCc1oc2ccc(N)cc2c1C(=O)c1cc(C)c(OCCCN(CCCC)CCCC)c(C)c1 |
| InChI | InChI=1S/C32H46N2O3/c1-6-9-13-29-30(27-22-26(33)14-15-28(27)37-29)31(35)25-20-23(4)32(24(5)21-25)36-19-12-18-34(16-10-7-2)17-11-8-3/h14-15,20-22H,6-13,16-19,33H2,1-5H3 |
| InChIKey | ZFWIRBAOPCZFJA-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|