C38H46N2O6 — CID 69360950
2-[[2-butyl-3-[4-[3-(dibutylamino)propoxy]benzoyl]-1-benzofuran-5-carbonyl]amino]benzoic acid (PubChem CID 69360950) has the molecular formula C38H46N2O6 and a molecular weight of 626.79 g/mol. Its IUPAC name is 2-[[2-butyl-3-[4-[3-(dibutylamino)propoxy]benzoyl]-1-benzofuran-5-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[2-butyl-3-[4-[3-(dibutylamino)propoxy]benzoyl]-1-benzofuran-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 69360950 |
| Molecular Formula | C38H46N2O6 |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | 2-[[2-butyl-3-[4-[3-(dibutylamino)propoxy]benzoyl]-1-benzofuran-5-carbonyl]amino]benzoic acid |
| SMILES | CCCCc1oc2ccc(C(=O)Nc3ccccc3C(=O)O)cc2c1C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C38H46N2O6/c1-4-7-15-34-35(31-26-28(18-21-33(31)46-34)37(42)39-32-14-11-10-13-30(32)38(43)44)36(41)27-16-19-29(20-17-27)45-25-12-24-40(22-8-5-2)23-9-6-3/h10-11,13-14,16-21,26H,4-9,12,15,22-25H2,1-3H3,(H,39,42)(H,43,44) |
| InChIKey | BYCRNZNOJMHKAF-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|