C24H28O3 — CID 71263713
(4-butoxyphenyl)-(2-butyl-5-methyl-1-benzofuran-3-yl)methanone (PubChem CID 71263713) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (4-butoxyphenyl)-(2-butyl-5-methyl-1-benzofuran-3-yl)methanone.
| Compound Name | (4-butoxyphenyl)-(2-butyl-5-methyl-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 71263713 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (4-butoxyphenyl)-(2-butyl-5-methyl-1-benzofuran-3-yl)methanone |
| SMILES | CCCCOc1ccc(C(=O)c2c(CCCC)oc3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C24H28O3/c1-4-6-8-22-23(20-16-17(3)9-14-21(20)27-22)24(25)18-10-12-19(13-11-18)26-15-7-5-2/h9-14,16H,4-8,15H2,1-3H3 |
| InChIKey | DUVYOFXZPLORTR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|