C22H24ClNO3 — CID 56926412
(5-amino-2-butyl-1-benzofuran-3-yl)-[4-(3-chloropropoxy)phenyl]methanone (PubChem CID 56926412) has the molecular formula C22H24ClNO3 and a molecular weight of 385.89 g/mol. Its IUPAC name is (5-amino-2-butyl-1-benzofuran-3-yl)-[4-(3-chloropropoxy)phenyl]methanone.
| Compound Name | (5-amino-2-butyl-1-benzofuran-3-yl)-[4-(3-chloropropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 56926412 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (5-amino-2-butyl-1-benzofuran-3-yl)-[4-(3-chloropropoxy)phenyl]methanone |
| SMILES | CCCCc1oc2ccc(N)cc2c1C(=O)c1ccc(OCCCCl)cc1 |
| InChI | InChI=1S/C22H24ClNO3/c1-2-3-5-20-21(18-14-16(24)8-11-19(18)27-20)22(25)15-6-9-17(10-7-15)26-13-4-12-23/h6-11,14H,2-5,12-13,24H2,1H3 |
| InChIKey | PLPCHRZZJPYGBP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|