C32H48N4O7S2 — CID 163858981
N-[3-[4-[3-[bis(butylamino)amino]propoxy]benzoyl]-2-butyl-1-benzofuran-5-yl]-N-methylsulfonylmethanesulfonamide (PubChem CID 163858981) has the molecular formula C32H48N4O7S2 and a molecular weight of 664.89 g/mol. Its IUPAC name is N-[3-[4-[3-[bis(butylamino)amino]propoxy]benzoyl]-2-butyl-1-benzofuran-5-yl]-N-methylsulfonylmethanesulfonamide.
| Compound Name | N-[3-[4-[3-[bis(butylamino)amino]propoxy]benzoyl]-2-butyl-1-benzofuran-5-yl]-N-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 163858981 |
| Molecular Formula | C32H48N4O7S2 |
| Molecular Weight | 664.89 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | N-[3-[4-[3-[bis(butylamino)amino]propoxy]benzoyl]-2-butyl-1-benzofuran-5-yl]-N-methylsulfonylmethanesulfonamide |
| SMILES | CCCCNN(CCCOc1ccc(C(=O)c2c(CCCC)oc3ccc(N(S(C)(=O)=O)S(C)(=O)=O)cc23)cc1)NCCCC |
| InChI | InChI=1S/C32H48N4O7S2/c1-6-9-13-30-31(28-24-26(16-19-29(28)43-30)36(44(4,38)39)45(5,40)41)32(37)25-14-17-27(18-15-25)42-23-12-22-35(33-20-10-7-2)34-21-11-8-3/h14-19,24,33-34H,6-13,20-23H2,1-5H3 |
| InChIKey | PAVIONHBBZFBGZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.89 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|