C24H25ClO5 — CID 141302889
methyl 2-butyl-3-[4-(3-chloropropoxy)benzoyl]-1-benzofuran-5-carboxylate (PubChem CID 141302889) has the molecular formula C24H25ClO5 and a molecular weight of 428.91 g/mol. Its IUPAC name is methyl 2-butyl-3-[4-(3-chloropropoxy)benzoyl]-1-benzofuran-5-carboxylate.
| Compound Name | methyl 2-butyl-3-[4-(3-chloropropoxy)benzoyl]-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 141302889 |
| Molecular Formula | C24H25ClO5 |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | methyl 2-butyl-3-[4-(3-chloropropoxy)benzoyl]-1-benzofuran-5-carboxylate |
| SMILES | CCCCc1oc2ccc(C(=O)OC)cc2c1C(=O)c1ccc(OCCCCl)cc1 |
| InChI | InChI=1S/C24H25ClO5/c1-3-4-6-21-22(19-15-17(24(27)28-2)9-12-20(19)30-21)23(26)16-7-10-18(11-8-16)29-14-5-13-25/h7-12,15H,3-6,13-14H2,1-2H3 |
| InChIKey | OENKPCVLYXYMBE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|