C26H31NO7 — CID 71498257
(2-butyl-5-nitro-1-benzofuran-3-yl)-[4-(3,3-diethoxypropoxy)phenyl]methanone (PubChem CID 71498257) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is (2-butyl-5-nitro-1-benzofuran-3-yl)-[4-(3,3-diethoxypropoxy)phenyl]methanone.
| Compound Name | (2-butyl-5-nitro-1-benzofuran-3-yl)-[4-(3,3-diethoxypropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 71498257 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | (2-butyl-5-nitro-1-benzofuran-3-yl)-[4-(3,3-diethoxypropoxy)phenyl]methanone |
| SMILES | CCCCc1oc2ccc([N+](=O)[O-])cc2c1C(=O)c1ccc(OCCC(OCC)OCC)cc1 |
| InChI | InChI=1S/C26H31NO7/c1-4-7-8-23-25(21-17-19(27(29)30)11-14-22(21)34-23)26(28)18-9-12-20(13-10-18)33-16-15-24(31-5-2)32-6-3/h9-14,17,24H,4-8,15-16H2,1-3H3 |
| InChIKey | VDWUSFYBCFKXCO-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 101.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|