C28H23NO4 — CID 155927268
(2-butyl-5-nitro-1-benzofuran-3-yl)-[4-[2-(4-methylphenyl)ethynyl]phenyl]methanone (PubChem CID 155927268) has the molecular formula C28H23NO4 and a molecular weight of 437.50 g/mol. Its IUPAC name is (2-butyl-5-nitro-1-benzofuran-3-yl)-[4-[2-(4-methylphenyl)ethynyl]phenyl]methanone.
| Compound Name | (2-butyl-5-nitro-1-benzofuran-3-yl)-[4-[2-(4-methylphenyl)ethynyl]phenyl]methanone |
|---|---|
| PubChem CID | 155927268 |
| Molecular Formula | C28H23NO4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | (2-butyl-5-nitro-1-benzofuran-3-yl)-[4-[2-(4-methylphenyl)ethynyl]phenyl]methanone |
| SMILES | CCCCc1oc2ccc([N+](=O)[O-])cc2c1C(=O)c1ccc(C#Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H23NO4/c1-3-4-5-26-27(24-18-23(29(31)32)16-17-25(24)33-26)28(30)22-14-12-21(13-15-22)11-10-20-8-6-19(2)7-9-20/h6-9,12-18H,3-5H2,1-2H3 |
| InChIKey | WZCIKARGZJJRSV-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 73.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|