C39H36Br2ClFO4 — CID 158008974
5-bromo-2-butyl-1-benzofuran;(5-bromo-2-butyl-1-benzofuran-3-yl)-(4-methylphenyl)methanone;4-fluorobenzoyl chloride (PubChem CID 158008974) has the molecular formula C39H36Br2ClFO4 and a molecular weight of 782.97 g/mol. Its IUPAC name is 5-bromo-2-butyl-1-benzofuran;(5-bromo-2-butyl-1-benzofuran-3-yl)-(4-methylphenyl)methanone;4-fluorobenzoyl chloride.
| Compound Name | 5-bromo-2-butyl-1-benzofuran;(5-bromo-2-butyl-1-benzofuran-3-yl)-(4-methylphenyl)methanone;4-fluorobenzoyl chloride |
|---|---|
| PubChem CID | 158008974 |
| Molecular Formula | C39H36Br2ClFO4 |
| Molecular Weight | 782.97 g/mol |
| Exact Mass | 780.07 |
| IUPAC Name | 5-bromo-2-butyl-1-benzofuran;(5-bromo-2-butyl-1-benzofuran-3-yl)-(4-methylphenyl)methanone;4-fluorobenzoyl chloride |
| SMILES | CCCCc1cc2cc(Br)ccc2o1.CCCCc1oc2ccc(Br)cc2c1C(=O)c1ccc(C)cc1.O=C(Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19BrO2.C12H13BrO.C7H4ClFO/c1-3-4-5-18-19(16-12-15(21)10-11-17(16)23-18)20(22)14-8-6-13(2)7-9-14;1-2-3-4-11-8-9-7-10(13)5-6-12(9)14-11;8-7(10)5-1-3-6(9)4-2-5/h6-12H,3-5H2,1-2H3;5-8H,2-4H2,1H3;1-4H |
| InChIKey | FEQKZNVJPVHHBD-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.97 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|