C21H20BrNO5 — CID 19754380
[4-(2-bromoethoxy)phenyl]-(2-butyl-5-nitro-1-benzofuran-3-yl)methanone (PubChem CID 19754380) has the molecular formula C21H20BrNO5 and a molecular weight of 446.30 g/mol. Its IUPAC name is [4-(2-bromoethoxy)phenyl]-(2-butyl-5-nitro-1-benzofuran-3-yl)methanone.
| Compound Name | [4-(2-bromoethoxy)phenyl]-(2-butyl-5-nitro-1-benzofuran-3-yl)methanone |
|---|---|
| PubChem CID | 19754380 |
| Molecular Formula | C21H20BrNO5 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | [4-(2-bromoethoxy)phenyl]-(2-butyl-5-nitro-1-benzofuran-3-yl)methanone |
| SMILES | CCCCc1oc2ccc([N+](=O)[O-])cc2c1C(=O)c1ccc(OCCBr)cc1 |
| InChI | InChI=1S/C21H20BrNO5/c1-2-3-4-19-20(17-13-15(23(25)26)7-10-18(17)28-19)21(24)14-5-8-16(9-6-14)27-12-11-22/h5-10,13H,2-4,11-12H2,1H3 |
| InChIKey | DIWFATGRCXGHPM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|