C30H40N2O5 — CID 72735129
(2-butyl-5-nitro-1-benzofuran-3-yl)-[4-[3,3-dideuterio-3-(dibutylamino)propoxy]phenyl]methanone (PubChem CID 72735129) has the molecular formula C30H40N2O5 and a molecular weight of 510.67 g/mol. Its IUPAC name is (2-butyl-5-nitro-1-benzofuran-3-yl)-[4-[3,3-dideuterio-3-(dibutylamino)propoxy]phenyl]methanone.
| Compound Name | (2-butyl-5-nitro-1-benzofuran-3-yl)-[4-[3,3-dideuterio-3-(dibutylamino)propoxy]phenyl]methanone |
|---|---|
| PubChem CID | 72735129 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | (2-butyl-5-nitro-1-benzofuran-3-yl)-[4-[3,3-dideuterio-3-(dibutylamino)propoxy]phenyl]methanone |
| SMILES | [2H]C([2H])(CCOc1ccc(C(=O)c2c(CCCC)oc3ccc([N+](=O)[O-])cc23)cc1)N(CCCC)CCCC |
| InChI | InChI=1S/C30H40N2O5/c1-4-7-11-28-29(26-22-24(32(34)35)14-17-27(26)37-28)30(33)23-12-15-25(16-13-23)36-21-10-20-31(18-8-5-2)19-9-6-3/h12-17,22H,4-11,18-21H2,1-3H3/i20D2 |
| InChIKey | YIYARJKYRBMMJG-FCLBBQIASA-N |
| XLogP | 7.59 |
| TPSA | 85.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|