C33H49N3O5S — CID 164609678
[2-butyl-5-(propan-2-ylsulfamoylamino)-1-benzofuran-3-yl]-[4-[3-(dibutylamino)propoxy]phenyl]methanone (PubChem CID 164609678) has the molecular formula C33H49N3O5S and a molecular weight of 599.84 g/mol. Its IUPAC name is [2-butyl-5-(propan-2-ylsulfamoylamino)-1-benzofuran-3-yl]-[4-[3-(dibutylamino)propoxy]phenyl]methanone.
| Compound Name | [2-butyl-5-(propan-2-ylsulfamoylamino)-1-benzofuran-3-yl]-[4-[3-(dibutylamino)propoxy]phenyl]methanone |
|---|---|
| PubChem CID | 164609678 |
| Molecular Formula | C33H49N3O5S |
| Molecular Weight | 599.84 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | [2-butyl-5-(propan-2-ylsulfamoylamino)-1-benzofuran-3-yl]-[4-[3-(dibutylamino)propoxy]phenyl]methanone |
| SMILES | CCCCc1oc2ccc(NS(=O)(=O)NC(C)C)cc2c1C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C33H49N3O5S/c1-6-9-13-31-32(29-24-27(16-19-30(29)41-31)35-42(38,39)34-25(4)5)33(37)26-14-17-28(18-15-26)40-23-12-22-36(20-10-7-2)21-11-8-3/h14-19,24-25,34-35H,6-13,20-23H2,1-5H3 |
| InChIKey | RNJHMOUMAAAICO-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.84 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|